C10H20Sn — CID 10868993
4,5-diethyl-1,1-dimethyl-2,3-dihydrostannole (PubChem CID 10868993) has the molecular formula C10H20Sn and a molecular weight of 258.98 g/mol. Its IUPAC name is 4,5-diethyl-1,1-dimethyl-2,3-dihydrostannole.
| Compound Name | 4,5-diethyl-1,1-dimethyl-2,3-dihydrostannole |
|---|---|
| PubChem CID | 10868993 |
| Molecular Formula | C10H20Sn |
| Molecular Weight | 258.98 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4,5-diethyl-1,1-dimethyl-2,3-dihydrostannole |
| SMILES | CCC1=C(CC)[Sn](C)(C)CC1 |
| InChI | InChI=1S/C8H14.2CH3.Sn/c1-4-7-8(5-2)6-3;;;/h2,4-6H2,1,3H3;2*1H3; |
| InChIKey | XHZORUUBANFRGC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.98 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |