C18H24N2O3 — CID 10870815
[(3R,6R,7aS)-3-tert-butyl-2-methyl-1-oxo-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-6-yl] benzoate (PubChem CID 10870815) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(3R,6R,7aS)-3-tert-butyl-2-methyl-1-oxo-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-6-yl] benzoate.
| Compound Name | [(3R,6R,7aS)-3-tert-butyl-2-methyl-1-oxo-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-6-yl] benzoate |
|---|---|
| PubChem CID | 10870815 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [(3R,6R,7aS)-3-tert-butyl-2-methyl-1-oxo-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-6-yl] benzoate |
| SMILES | CN1C(=O)[C@@H]2C[C@@H](OC(=O)c3ccccc3)CN2[C@H]1C(C)(C)C |
| InChI | InChI=1S/C18H24N2O3/c1-18(2,3)17-19(4)15(21)14-10-13(11-20(14)17)23-16(22)12-8-6-5-7-9-12/h5-9,13-14,17H,10-11H2,1-4H3/t13-,14+,17+/m1/s1 |
| InChIKey | LIOPYEGNYQJRDG-KEYYUXOJSA-N |
| XLogP | 2.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |