C14H14N2O4 — CID 69474789
(1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl) benzoate (PubChem CID 69474789) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is (1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl) benzoate.
| Compound Name | (1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl) benzoate |
|---|---|
| PubChem CID | 69474789 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl) benzoate |
| SMILES | O=C(OC1CC2C(=O)NCC(=O)N2C1)c1ccccc1 |
| InChI | InChI=1S/C14H14N2O4/c17-12-7-15-13(18)11-6-10(8-16(11)12)20-14(19)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,15,18) |
| InChIKey | IRUKRHIFEBFTQS-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |