C18H17NO6 — CID 10871630
methyl 8-methoxy-4-methyl-6,9-dioxo-9a-phenyl-4H-pyrido[2,1-b][1,3]oxazine-7-carboxylate (PubChem CID 10871630) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is methyl 8-methoxy-4-methyl-6,9-dioxo-9a-phenyl-4H-pyrido[2,1-b][1,3]oxazine-7-carboxylate.
| Compound Name | methyl 8-methoxy-4-methyl-6,9-dioxo-9a-phenyl-4H-pyrido[2,1-b][1,3]oxazine-7-carboxylate |
|---|---|
| PubChem CID | 10871630 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | methyl 8-methoxy-4-methyl-6,9-dioxo-9a-phenyl-4H-pyrido[2,1-b][1,3]oxazine-7-carboxylate |
| SMILES | COC(=O)C1=C(OC)C(=O)C2(c3ccccc3)OC=CC(C)N2C1=O |
| InChI | InChI=1S/C18H17NO6/c1-11-9-10-25-18(12-7-5-4-6-8-12)15(20)14(23-2)13(17(22)24-3)16(21)19(11)18/h4-11H,1-3H3 |
| InChIKey | OJBUDVVCCFHMDL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|