C16H15NO7 — CID 10958546
methyl 6-acetyloxy-4-methoxy-2,5-dioxo-6-phenyl-1H-pyridine-3-carboxylate (PubChem CID 10958546) has the molecular formula C16H15NO7 and a molecular weight of 333.30 g/mol. Its IUPAC name is methyl 6-acetyloxy-4-methoxy-2,5-dioxo-6-phenyl-1H-pyridine-3-carboxylate.
| Compound Name | methyl 6-acetyloxy-4-methoxy-2,5-dioxo-6-phenyl-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10958546 |
| Molecular Formula | C16H15NO7 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | methyl 6-acetyloxy-4-methoxy-2,5-dioxo-6-phenyl-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(OC)C(=O)C(OC(C)=O)(c2ccccc2)NC1=O |
| InChI | InChI=1S/C16H15NO7/c1-9(18)24-16(10-7-5-4-6-8-10)13(19)12(22-2)11(14(20)17-16)15(21)23-3/h4-8H,1-3H3,(H,17,20) |
| InChIKey | GJDZIOGUALVGEC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|