C14H13NO5 — CID 11044004
(4-methoxy-3,6-dioxo-2-phenyl-1H-pyridin-2-yl) acetate (PubChem CID 11044004) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is (4-methoxy-3,6-dioxo-2-phenyl-1H-pyridin-2-yl) acetate.
| Compound Name | (4-methoxy-3,6-dioxo-2-phenyl-1H-pyridin-2-yl) acetate |
|---|---|
| PubChem CID | 11044004 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (4-methoxy-3,6-dioxo-2-phenyl-1H-pyridin-2-yl) acetate |
| SMILES | COC1=CC(=O)NC(OC(C)=O)(c2ccccc2)C1=O |
| InChI | InChI=1S/C14H13NO5/c1-9(16)20-14(10-6-4-3-5-7-10)13(18)11(19-2)8-12(17)15-14/h3-8H,1-2H3,(H,15,17) |
| InChIKey | KVBVUSTWZVBLMK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |