C14H13NO6 — CID 11000794
methyl 6-hydroxy-4-methoxy-2,5-dioxo-6-phenyl-1H-pyridine-3-carboxylate (PubChem CID 11000794) has the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. Its IUPAC name is methyl 6-hydroxy-4-methoxy-2,5-dioxo-6-phenyl-1H-pyridine-3-carboxylate.
| Compound Name | methyl 6-hydroxy-4-methoxy-2,5-dioxo-6-phenyl-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 11000794 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | methyl 6-hydroxy-4-methoxy-2,5-dioxo-6-phenyl-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(OC)C(=O)C(O)(c2ccccc2)NC1=O |
| InChI | InChI=1S/C14H13NO6/c1-20-10-9(13(18)21-2)12(17)15-14(19,11(10)16)8-6-4-3-5-7-8/h3-7,19H,1-2H3,(H,15,17) |
| InChIKey | MSGFIOBSFRPAGT-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|