C14H18O2S8 — CID 10874422
dimethyl 6,9-dioxa-3,12,15,16-tetrathiabicyclo[12.1.1]hexadeca-1,13-diene-2,13-dicarbodithioate (PubChem CID 10874422) has the molecular formula C14H18O2S8 and a molecular weight of 474.83 g/mol. Its IUPAC name is dimethyl 6,9-dioxa-3,12,15,16-tetrathiabicyclo[12.1.1]hexadeca-1,13-diene-2,13-dicarbodithioate.
| Compound Name | dimethyl 6,9-dioxa-3,12,15,16-tetrathiabicyclo[12.1.1]hexadeca-1,13-diene-2,13-dicarbodithioate |
|---|---|
| PubChem CID | 10874422 |
| Molecular Formula | C14H18O2S8 |
| Molecular Weight | 474.83 g/mol |
| Exact Mass | 473.91 |
| IUPAC Name | dimethyl 6,9-dioxa-3,12,15,16-tetrathiabicyclo[12.1.1]hexadeca-1,13-diene-2,13-dicarbodithioate |
| SMILES | CSC(=S)C1=c2sc(s2)=C(C(=S)SC)SCCOCCOCCS1 |
| InChI | InChI=1S/C14H18O2S8/c1-19-11(17)9-13-23-14(24-13)10(12(18)20-2)22-8-6-16-4-3-15-5-7-21-9/h3-8H2,1-2H3/b13-9-,14-10- |
| InChIKey | DBAFIYRENOWYLG-FOIMCPNXSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.83 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|