C13H20O4S5 — CID 15044106
5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-ene-20-thione (PubChem CID 15044106) has the molecular formula C13H20O4S5 and a molecular weight of 400.63 g/mol. Its IUPAC name is 5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-ene-20-thione.
| Compound Name | 5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-ene-20-thione |
|---|---|
| PubChem CID | 15044106 |
| Molecular Formula | C13H20O4S5 |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-ene-20-thione |
| SMILES | S=c1sc2c(s1)SCCOCCOCCOCCOCCS2 |
| InChI | InChI=1S/C13H20O4S5/c18-13-21-11-12(22-13)20-10-8-17-6-4-15-2-1-14-3-5-16-7-9-19-11/h1-10H2 |
| InChIKey | HAZMPMFFUAXFOY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|