C14H16O2S10 — CID 10347128
5,17-dioxa-2,8,10,12,14,20,22,24-octathiatricyclo[19.3.0.09,13]tetracosa-1(21),9(13)-diene-11,23-dithione (PubChem CID 10347128) has the molecular formula C14H16O2S10 and a molecular weight of 536.95 g/mol. Its IUPAC name is 5,17-dioxa-2,8,10,12,14,20,22,24-octathiatricyclo[19.3.0.09,13]tetracosa-1(21),9(13)-diene-11,23-dithione.
| Compound Name | 5,17-dioxa-2,8,10,12,14,20,22,24-octathiatricyclo[19.3.0.09,13]tetracosa-1(21),9(13)-diene-11,23-dithione |
|---|---|
| PubChem CID | 10347128 |
| Molecular Formula | C14H16O2S10 |
| Molecular Weight | 536.95 g/mol |
| Exact Mass | 535.84 |
| IUPAC Name | 5,17-dioxa-2,8,10,12,14,20,22,24-octathiatricyclo[19.3.0.09,13]tetracosa-1(21),9(13)-diene-11,23-dithione |
| SMILES | S=c1sc2c(s1)SCCOCCSc1sc(=S)sc1SCCOCCS2 |
| InChI | InChI=1S/C14H16O2S10/c17-13-23-9-10(24-13)21-7-3-16-4-8-22-12-11(25-14(18)26-12)20-6-2-15-1-5-19-9/h1-8H2 |
| InChIKey | RLDCDOWWQHRHDM-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.95 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|