C10H14OS3 — CID 129198517
8,10-dimethyl-2,3,5,6-tetrahydrothieno[3,4-e][1,4,7]oxadithionine (PubChem CID 129198517) has the molecular formula C10H14OS3 and a molecular weight of 246.42 g/mol. Its IUPAC name is 8,10-dimethyl-2,3,5,6-tetrahydrothieno[3,4-e][1,4,7]oxadithionine.
| Compound Name | 8,10-dimethyl-2,3,5,6-tetrahydrothieno[3,4-e][1,4,7]oxadithionine |
|---|---|
| PubChem CID | 129198517 |
| Molecular Formula | C10H14OS3 |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 8,10-dimethyl-2,3,5,6-tetrahydrothieno[3,4-e][1,4,7]oxadithionine |
| SMILES | Cc1sc(C)c2c1SCCOCCS2 |
| InChI | InChI=1S/C10H14OS3/c1-7-9-10(8(2)14-7)13-6-4-11-3-5-12-9/h3-6H2,1-2H3 |
| InChIKey | BIZSUNANOBVUIN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |