C30H41NO5Si — CID 10875050
tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-[(E)-3-oxoprop-1-enyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 10875050) has the molecular formula C30H41NO5Si and a molecular weight of 523.75 g/mol. Its IUPAC name is tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-[(E)-3-oxoprop-1-enyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-[(E)-3-oxoprop-1-enyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10875050 |
| Molecular Formula | C30H41NO5Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-[(E)-3-oxoprop-1-enyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](/C=C/C=O)OC1(C)C |
| InChI | InChI=1S/C30H41NO5Si/c1-28(2,3)36-27(33)31-25(26(20-15-21-32)35-30(31,7)8)22-34-37(29(4,5)6,23-16-11-9-12-17-23)24-18-13-10-14-19-24/h9-21,25-26H,22H2,1-8H3/b20-15+/t25-,26-/m1/s1 |
| InChIKey | AHDXBHDLIZWQRX-JQJCMXQBSA-N |
| XLogP | 5.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|