C21H19NO5 — CID 108766557
3-hydroxy-4-(4-naphthalen-2-yloxybutanoylamino)benzoic acid (PubChem CID 108766557) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-hydroxy-4-(4-naphthalen-2-yloxybutanoylamino)benzoic acid.
| Compound Name | 3-hydroxy-4-(4-naphthalen-2-yloxybutanoylamino)benzoic acid |
|---|---|
| PubChem CID | 108766557 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 3-hydroxy-4-(4-naphthalen-2-yloxybutanoylamino)benzoic acid |
| SMILES | O=C(CCCOc1ccc2ccccc2c1)Nc1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C21H19NO5/c23-19-13-16(21(25)26)8-10-18(19)22-20(24)6-3-11-27-17-9-7-14-4-1-2-5-15(14)12-17/h1-2,4-5,7-10,12-13,23H,3,6,11H2,(H,22,24)(H,25,26) |
| InChIKey | HMLZDNBQEBDCAS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|