C24H23NO4 — CID 139665889
2-[[(E)-7-naphthalen-2-yloxyhept-5-enoyl]amino]benzoic acid (PubChem CID 139665889) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[[(E)-7-naphthalen-2-yloxyhept-5-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-7-naphthalen-2-yloxyhept-5-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 139665889 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-[[(E)-7-naphthalen-2-yloxyhept-5-enoyl]amino]benzoic acid |
| SMILES | O=C(CCC/C=C/COc1ccc2ccccc2c1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C24H23NO4/c26-23(25-22-12-7-6-11-21(22)24(27)28)13-3-1-2-8-16-29-20-15-14-18-9-4-5-10-19(18)17-20/h2,4-12,14-15,17H,1,3,13,16H2,(H,25,26)(H,27,28)/b8-2+ |
| InChIKey | MTQGDOFKERHJHX-KRXBUXKQSA-N |
| XLogP | 5.28 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|