2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid

C24H21NO3 — CID 139665917

IUPAC2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid
SMILESO=C(CCC=CC=Cc1ccc2ccccc2c1)Nc1ccccc1C(=O)O
InChIInChI=1S/C24H21NO3/c26-23(25-22-13-8-7-12-21(22)24(27)28)14-4-2-1-3-9-18-15-16-19-10-5-6-11-20(19)17-18/h1-3,5-13,15-17H,4,14H2,(H,25,26)(H,27,28)
InChIKeyKXSGLTPWLWGAGO-UHFFFAOYSA-N
MW371.44 g/mol
LogP5.53
Rot. Bonds7

About 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid

2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid (PubChem CID 139665917) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid.

Molecular Properties

Compound Name2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid
PubChem CID139665917
Molecular FormulaC24H21NO3
Molecular Weight371.44 g/mol
Exact Mass371.15
IUPAC Name2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid
SMILESO=C(CCC=CC=Cc1ccc2ccccc2c1)Nc1ccccc1C(=O)O
InChIInChI=1S/C24H21NO3/c26-23(25-22-13-8-7-12-21(22)24(27)28)14-4-2-1-3-9-18-15-16-19-10-5-6-11-20(19)17-18/h1-3,5-13,15-17H,4,14H2,(H,25,26)(H,27,28)
InChIKeyKXSGLTPWLWGAGO-UHFFFAOYSA-N
XLogP5.53
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms28
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500371.44
LogP ≤ 55.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid?
The IUPAC name of 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid (CID 139665917) is 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid.
What is the SMILES notation for 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid?
The canonical SMILES for 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid is O=C(CCC=CC=Cc1ccc2ccccc2c1)Nc1ccccc1C(=O)O.
What is the InChIKey of 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid?
The InChIKey is KXSGLTPWLWGAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21NO3/c26-23(25-22-13-8-7-12-21(22)24(27)28)14-4-2-1-3-9-18-15-16-19-10-5-6-11-20(19)17-18/h1-3,5-13,15-17H,4,14H2,(H,25,26)(H,27,28).
What are the key properties of 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid?
2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid has a molecular weight of 371.44 g/mol, XLogP of 5.53, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid is sourced from PubChem (CID 139665917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).