C24H21NO3 — CID 139665917
2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid (PubChem CID 139665917) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid.
| Compound Name | 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid |
|---|---|
| PubChem CID | 139665917 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-(7-naphthalen-2-ylhepta-4,6-dienoylamino)benzoic acid |
| SMILES | O=C(CCC=CC=Cc1ccc2ccccc2c1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C24H21NO3/c26-23(25-22-13-8-7-12-21(22)24(27)28)14-4-2-1-3-9-18-15-16-19-10-5-6-11-20(19)17-18/h1-3,5-13,15-17H,4,14H2,(H,25,26)(H,27,28) |
| InChIKey | KXSGLTPWLWGAGO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|