C25H22N4O3 — CID 108773752
ethyl 4-[2-hydroxy-N-(pyridin-2-ylmethyl)anilino]-2-phenylpyrimidine-5-carboxylate (PubChem CID 108773752) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is ethyl 4-[2-hydroxy-N-(pyridin-2-ylmethyl)anilino]-2-phenylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[2-hydroxy-N-(pyridin-2-ylmethyl)anilino]-2-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 108773752 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | ethyl 4-[2-hydroxy-N-(pyridin-2-ylmethyl)anilino]-2-phenylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccccc2)nc1N(Cc1ccccn1)c1ccccc1O |
| InChI | InChI=1S/C25H22N4O3/c1-2-32-25(31)20-16-27-23(18-10-4-3-5-11-18)28-24(20)29(17-19-12-8-9-15-26-19)21-13-6-7-14-22(21)30/h3-16,30H,2,17H2,1H3 |
| InChIKey | VDSGRDIPGGRZTL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |