C21H23N3O6S — CID 108774544
4-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-3-nitrobenzenesulfonamide (PubChem CID 108774544) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is 4-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 108774544 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 4-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc2c(c1C)OC1(CCN(c3ccc(S(N)(=O)=O)cc3[N+](=O)[O-])CC1)CC2=O |
| InChI | InChI=1S/C21H23N3O6S/c1-13-3-5-16-19(25)12-21(30-20(16)14(13)2)7-9-23(10-8-21)17-6-4-15(31(22,28)29)11-18(17)24(26)27/h3-6,11H,7-10,12H2,1-2H3,(H2,22,28,29) |
| InChIKey | LLOICAWELZKHLU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|