C16H17ClN6O3 — CID 108776779
[4-[(6-chloro-5-nitropyrimidin-4-yl)amino]phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 108776779) has the molecular formula C16H17ClN6O3 and a molecular weight of 376.80 g/mol. Its IUPAC name is [4-[(6-chloro-5-nitropyrimidin-4-yl)amino]phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-[(6-chloro-5-nitropyrimidin-4-yl)amino]phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 108776779 |
| Molecular Formula | C16H17ClN6O3 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [4-[(6-chloro-5-nitropyrimidin-4-yl)amino]phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(Nc3ncnc(Cl)c3[N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C16H17ClN6O3/c1-21-6-8-22(9-7-21)16(24)11-2-4-12(5-3-11)20-15-13(23(25)26)14(17)18-10-19-15/h2-5,10H,6-9H2,1H3,(H,18,19,20) |
| InChIKey | MBEBHQCOXYYIHD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|