About N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine
N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine (PubChem CID 10880776) has the molecular formula C15H31NS2
and a molecular weight of 289.55 g/mol. Its IUPAC name is N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine.
Molecular Properties
| Compound Name | N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine |
| PubChem CID | 10880776 |
| Molecular Formula | C15H31NS2 |
| Molecular Weight | 289.55 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine |
| SMILES | CCCCN(CC=C(SCC)SCC)CCCC |
| InChI | InChI=1S/C15H31NS2/c1-5-9-12-16(13-10-6-2)14-11-15(17-7-3)18-8-4/h11H,5-10,12-14H2,1-4H3 |
| InChIKey | KGQUOOVQWTXJFW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine?
The IUPAC name of N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine (CID 10880776) is N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine.
What is the SMILES notation for N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine?
The canonical SMILES for N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine is CCCCN(CC=C(SCC)SCC)CCCC.
What is the InChIKey of N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine?
The InChIKey is KGQUOOVQWTXJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NS2/c1-5-9-12-16(13-10-6-2)14-11-15(17-7-3)18-8-4/h11H,5-10,12-14H2,1-4H3.
What are the key properties of N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine?
N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine has a molecular weight of 289.55 g/mol, XLogP of 5.24, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,3-bis(ethylsulfanyl)prop-2-enyl]-N-butylbutan-1-amine is sourced from PubChem (CID 10880776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).