C11H23NS2 — CID 10911463
N,N-diethyl-3,3-bis(ethylsulfanyl)prop-2-en-1-amine (PubChem CID 10911463) has the molecular formula C11H23NS2 and a molecular weight of 233.45 g/mol. Its IUPAC name is N,N-diethyl-3,3-bis(ethylsulfanyl)prop-2-en-1-amine.
| Compound Name | N,N-diethyl-3,3-bis(ethylsulfanyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 10911463 |
| Molecular Formula | C11H23NS2 |
| Molecular Weight | 233.45 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | N,N-diethyl-3,3-bis(ethylsulfanyl)prop-2-en-1-amine |
| SMILES | CCSC(=CCN(CC)CC)SCC |
| InChI | InChI=1S/C11H23NS2/c1-5-12(6-2)10-9-11(13-7-3)14-8-4/h9H,5-8,10H2,1-4H3 |
| InChIKey | ZBCVBDSZZYKRBB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |