C13H23NS2 — CID 11032546
3,3-bis(ethylsulfanyl)-N,N-bis(prop-2-enyl)prop-2-en-1-amine (PubChem CID 11032546) has the molecular formula C13H23NS2 and a molecular weight of 257.47 g/mol. Its IUPAC name is 3,3-bis(ethylsulfanyl)-N,N-bis(prop-2-enyl)prop-2-en-1-amine.
| Compound Name | 3,3-bis(ethylsulfanyl)-N,N-bis(prop-2-enyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 11032546 |
| Molecular Formula | C13H23NS2 |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 3,3-bis(ethylsulfanyl)-N,N-bis(prop-2-enyl)prop-2-en-1-amine |
| SMILES | C=CCN(CC=C)CC=C(SCC)SCC |
| InChI | InChI=1S/C13H23NS2/c1-5-10-14(11-6-2)12-9-13(15-7-3)16-8-4/h5-6,9H,1-2,7-8,10-12H2,3-4H3 |
| InChIKey | JPUCTRYOWCPMSX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|