C20H23NO2 — CID 10881427
(2R,6R)-1-benzyl-2-[(1S)-1-hydroxyethyl]-6-phenylpiperidin-4-one (PubChem CID 10881427) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2R,6R)-1-benzyl-2-[(1S)-1-hydroxyethyl]-6-phenylpiperidin-4-one.
| Compound Name | (2R,6R)-1-benzyl-2-[(1S)-1-hydroxyethyl]-6-phenylpiperidin-4-one |
|---|---|
| PubChem CID | 10881427 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2R,6R)-1-benzyl-2-[(1S)-1-hydroxyethyl]-6-phenylpiperidin-4-one |
| SMILES | C[C@H](O)[C@H]1CC(=O)C[C@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c1-15(22)19-12-18(23)13-20(17-10-6-3-7-11-17)21(19)14-16-8-4-2-5-9-16/h2-11,15,19-20,22H,12-14H2,1H3/t15-,19+,20+/m0/s1 |
| InChIKey | LYTFTYJAFIFDKG-CWFSZBLJSA-N |
| XLogP | 3.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |