About (4-sulfamoylphenyl)methyl 2-propylpentanoate
(4-sulfamoylphenyl)methyl 2-propylpentanoate (PubChem CID 10881548) has the molecular formula C15H23NO4S
and a molecular weight of 313.42 g/mol. Its IUPAC name is (4-sulfamoylphenyl)methyl 2-propylpentanoate.
Molecular Properties
| Compound Name | (4-sulfamoylphenyl)methyl 2-propylpentanoate |
| PubChem CID | 10881548 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (4-sulfamoylphenyl)methyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H23NO4S/c1-3-5-13(6-4-2)15(17)20-11-12-7-9-14(10-8-12)21(16,18)19/h7-10,13H,3-6,11H2,1-2H3,(H2,16,18,19) |
| InChIKey | MSITXBOMUACCFV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-sulfamoylphenyl)methyl 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-sulfamoylphenyl)methyl 2-propylpentanoate?
The IUPAC name of (4-sulfamoylphenyl)methyl 2-propylpentanoate (CID 10881548) is (4-sulfamoylphenyl)methyl 2-propylpentanoate.
What is the SMILES notation for (4-sulfamoylphenyl)methyl 2-propylpentanoate?
The canonical SMILES for (4-sulfamoylphenyl)methyl 2-propylpentanoate is CCCC(CCC)C(=O)OCc1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of (4-sulfamoylphenyl)methyl 2-propylpentanoate?
The InChIKey is MSITXBOMUACCFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO4S/c1-3-5-13(6-4-2)15(17)20-11-12-7-9-14(10-8-12)21(16,18)19/h7-10,13H,3-6,11H2,1-2H3,(H2,16,18,19).
What are the key properties of (4-sulfamoylphenyl)methyl 2-propylpentanoate?
(4-sulfamoylphenyl)methyl 2-propylpentanoate has a molecular weight of 313.42 g/mol, XLogP of 2.59, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-sulfamoylphenyl)methyl 2-propylpentanoate is sourced from PubChem (CID 10881548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).