C15H15Cl2N3O2 — CID 108821705
(Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(oxolan-2-ylmethylamino)prop-2-enamide (PubChem CID 108821705) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(oxolan-2-ylmethylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(oxolan-2-ylmethylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108821705 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(oxolan-2-ylmethylamino)prop-2-enamide |
| SMILES | N#C/C(=C/NCC1CCCO1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2N3O2/c16-13-4-3-11(6-14(13)17)20-15(21)10(7-18)8-19-9-12-2-1-5-22-12/h3-4,6,8,12,19H,1-2,5,9H2,(H,20,21)/b10-8- |
| InChIKey | GNBHVYRFIBMKOY-NTMALXAHSA-N |
| XLogP | 3.11 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|