C16H19Cl2N5O — CID 108821772
(Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2-piperazin-1-ylethylamino)prop-2-enamide (PubChem CID 108821772) has the molecular formula C16H19Cl2N5O and a molecular weight of 368.27 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2-piperazin-1-ylethylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2-piperazin-1-ylethylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108821772 |
| Molecular Formula | C16H19Cl2N5O |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2-piperazin-1-ylethylamino)prop-2-enamide |
| SMILES | N#C/C(=C/NCCN1CCNCC1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2N5O/c17-14-2-1-13(9-15(14)18)22-16(24)12(10-19)11-21-5-8-23-6-3-20-4-7-23/h1-2,9,11,20-21H,3-8H2,(H,22,24)/b12-11- |
| InChIKey | ZUPNZYGVIFDNOD-QXMHVHEDSA-N |
| XLogP | 1.83 |
| TPSA | 80.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|