C20H27ClN4O2 — CID 108827773
(Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-enamide (PubChem CID 108827773) has the molecular formula C20H27ClN4O2 and a molecular weight of 390.92 g/mol. Its IUPAC name is (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-enamide.
| Compound Name | (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108827773 |
| Molecular Formula | C20H27ClN4O2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)/C(C#N)=C\NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H27ClN4O2/c1-19(2)9-15(10-20(3,4)25-19)23-12-13(11-22)18(26)24-16-8-14(21)6-7-17(16)27-5/h6-8,12,15,23,25H,9-10H2,1-5H3,(H,24,26)/b13-12- |
| InChIKey | DIICLTWBBZGBNB-SEYXRHQNSA-N |
| XLogP | 3.59 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|