C19H27N5O — CID 108818079
(Z)-N-(4-aminophenyl)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-enamide (PubChem CID 108818079) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is (Z)-N-(4-aminophenyl)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-enamide.
| Compound Name | (Z)-N-(4-aminophenyl)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108818079 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (Z)-N-(4-aminophenyl)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]prop-2-enamide |
| SMILES | CC1(C)CC(N/C=C(/C#N)C(=O)Nc2ccc(N)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C19H27N5O/c1-18(2)9-16(10-19(3,4)24-18)22-12-13(11-20)17(25)23-15-7-5-14(21)6-8-15/h5-8,12,16,22,24H,9-10,21H2,1-4H3,(H,23,25)/b13-12- |
| InChIKey | GPKMDAMKUALAIZ-SEYXRHQNSA-N |
| XLogP | 2.51 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|