C16H26O6Si2 — CID 10883172
(2R)-2-[(1R,2R)-2-[(2R)-5-oxo-2H-furan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-2H-furan-5-one (PubChem CID 10883172) has the molecular formula C16H26O6Si2 and a molecular weight of 370.55 g/mol. Its IUPAC name is (2R)-2-[(1R,2R)-2-[(2R)-5-oxo-2H-furan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-2H-furan-5-one.
| Compound Name | (2R)-2-[(1R,2R)-2-[(2R)-5-oxo-2H-furan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 10883172 |
| Molecular Formula | C16H26O6Si2 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | (2R)-2-[(1R,2R)-2-[(2R)-5-oxo-2H-furan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-2H-furan-5-one |
| SMILES | C[Si](C)(C)O[C@@H]([C@H](O[Si](C)(C)C)[C@H]1C=CC(=O)O1)[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C16H26O6Si2/c1-23(2,3)21-15(11-7-9-13(17)19-11)16(22-24(4,5)6)12-8-10-14(18)20-12/h7-12,15-16H,1-6H3/t11-,12-,15-,16-/m1/s1 |
| InChIKey | WFZYCVVRYLXGEW-CZPYZCIJSA-N |
| XLogP | 2.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|