C28H52O8Si2 — CID 5366453
2-trimethylsilylethyl (E)-5-[(E)-3-[2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolan-4-yl]prop-2-enoyl]oxyhex-2-enoate (PubChem CID 5366453) has the molecular formula C28H52O8Si2 and a molecular weight of 572.89 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E)-5-[(E)-3-[2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolan-4-yl]prop-2-enoyl]oxyhex-2-enoate.
| Compound Name | 2-trimethylsilylethyl (E)-5-[(E)-3-[2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolan-4-yl]prop-2-enoyl]oxyhex-2-enoate |
|---|---|
| PubChem CID | 5366453 |
| Molecular Formula | C28H52O8Si2 |
| Molecular Weight | 572.89 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | 2-trimethylsilylethyl (E)-5-[(E)-3-[2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolan-4-yl]prop-2-enoyl]oxyhex-2-enoate |
| SMILES | CC(CC1OC(C)(C)OC1/C=C/C(=O)OC(C)C/C=C/C(=O)OCC[Si](C)(C)C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C28H52O8Si2/c1-22(12-11-13-26(29)32-17-19-38(8,9)10)34-27(30)15-14-24-25(36-28(3,4)35-24)20-23(2)33-21-31-16-18-37(5,6)7/h11,13-15,22-25H,12,16-21H2,1-10H3/b13-11+,15-14+ |
| InChIKey | WILKQSKBXOJYGT-VVOKNZMXSA-N |
| XLogP | 5.93 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.89 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|