C12H8Cl2F3N5O3 — CID 10883837
N-[1-[3,6-dichloro-5-(trifluoromethyl)-2-pyridinyl]-4-nitropyrazol-5-yl]propanamide (PubChem CID 10883837) has the molecular formula C12H8Cl2F3N5O3 and a molecular weight of 398.13 g/mol. Its IUPAC name is N-[1-[3,6-dichloro-5-(trifluoromethyl)-2-pyridinyl]-4-nitropyrazol-5-yl]propanamide.
| Compound Name | N-[1-[3,6-dichloro-5-(trifluoromethyl)-2-pyridinyl]-4-nitropyrazol-5-yl]propanamide |
|---|---|
| PubChem CID | 10883837 |
| Molecular Formula | C12H8Cl2F3N5O3 |
| Molecular Weight | 398.13 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | N-[1-[3,6-dichloro-5-(trifluoromethyl)-2-pyridinyl]-4-nitropyrazol-5-yl]propanamide |
| SMILES | CCC(=O)Nc1c([N+](=O)[O-])cnn1-c1nc(Cl)c(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H8Cl2F3N5O3/c1-2-8(23)19-11-7(22(24)25)4-18-21(11)10-6(13)3-5(9(14)20-10)12(15,16)17/h3-4H,2H2,1H3,(H,19,23) |
| InChIKey | VGTGHXZNCXQUDS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.13 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|