C12H3Cl3F6KN4O3+ — CID 23686078
potassium 2,2,2-trifluoro-N-[4-nitro-1-[2,3,6-trichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]acetamide (PubChem CID 23686078) has the molecular formula C12H3Cl3F6KN4O3+ and a molecular weight of 510.63 g/mol. Its IUPAC name is potassium 2,2,2-trifluoro-N-[4-nitro-1-[2,3,6-trichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]acetamide.
| Compound Name | potassium 2,2,2-trifluoro-N-[4-nitro-1-[2,3,6-trichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 23686078 |
| Molecular Formula | C12H3Cl3F6KN4O3+ |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 508.88 |
| IUPAC Name | potassium 2,2,2-trifluoro-N-[4-nitro-1-[2,3,6-trichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]acetamide |
| SMILES | O=C(Nc1c([N+](=O)[O-])cnn1-c1c(Cl)cc(C(F)(F)F)c(Cl)c1Cl)C(F)(F)F.[K+] |
| InChI | InChI=1S/C12H3Cl3F6N4O3.K/c13-4-1-3(11(16,17)18)6(14)7(15)8(4)24-9(5(2-22-24)25(27)28)23-10(26)12(19,20)21;/h1-2H,(H,23,26);/q;+1 |
| InChIKey | FGOBEQZCNQVDSJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|