C19H27F3INO3Si — CID 10885931
2,2,2-trifluoro-N-[2-(2-iodo-4,5-dimethoxyphenyl)ethyl]-N-[(Z)-4-trimethylsilylbut-2-enyl]acetamide (PubChem CID 10885931) has the molecular formula C19H27F3INO3Si and a molecular weight of 529.41 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(2-iodo-4,5-dimethoxyphenyl)ethyl]-N-[(Z)-4-trimethylsilylbut-2-enyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(2-iodo-4,5-dimethoxyphenyl)ethyl]-N-[(Z)-4-trimethylsilylbut-2-enyl]acetamide |
|---|---|
| PubChem CID | 10885931 |
| Molecular Formula | C19H27F3INO3Si |
| Molecular Weight | 529.41 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(2-iodo-4,5-dimethoxyphenyl)ethyl]-N-[(Z)-4-trimethylsilylbut-2-enyl]acetamide |
| SMILES | COc1cc(I)c(CCN(C/C=C\C[Si](C)(C)C)C(=O)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C19H27F3INO3Si/c1-26-16-12-14(15(23)13-17(16)27-2)8-10-24(18(25)19(20,21)22)9-6-7-11-28(3,4)5/h6-7,12-13H,8-11H2,1-5H3/b7-6- |
| InChIKey | UEQHTSRXTBAHAY-SREVYHEPSA-N |
| XLogP | 5.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|