C34H62O7Si2 — CID 10886753
(2R,4S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-8-methoxy-1-[(4-methoxyphenyl)methoxy]-2-triethylsilyloxytridec-12-en-6-one (PubChem CID 10886753) has the molecular formula C34H62O7Si2 and a molecular weight of 639.04 g/mol. Its IUPAC name is (2R,4S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-8-methoxy-1-[(4-methoxyphenyl)methoxy]-2-triethylsilyloxytridec-12-en-6-one.
| Compound Name | (2R,4S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-8-methoxy-1-[(4-methoxyphenyl)methoxy]-2-triethylsilyloxytridec-12-en-6-one |
|---|---|
| PubChem CID | 10886753 |
| Molecular Formula | C34H62O7Si2 |
| Molecular Weight | 639.04 g/mol |
| Exact Mass | 638.40 |
| IUPAC Name | (2R,4S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-8-methoxy-1-[(4-methoxyphenyl)methoxy]-2-triethylsilyloxytridec-12-en-6-one |
| SMILES | C=CC[C@H](C[C@@H](CC(=O)C[C@@H](O)C[C@H](COCc1ccc(OC)cc1)O[Si](CC)(CC)CC)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H62O7Si2/c1-12-16-31(40-42(10,11)34(5,6)7)24-32(38-9)22-28(35)21-29(36)23-33(41-43(13-2,14-3)15-4)26-39-25-27-17-19-30(37-8)20-18-27/h12,17-20,29,31-33,36H,1,13-16,21-26H2,2-11H3/t29-,31-,32-,33-/m1/s1 |
| InChIKey | SCOXGBQYPXMTQW-WXQJYUTRSA-N |
| XLogP | 8.07 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.04 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|