C45H62O3S2Si2 — CID 10887222
tert-butyl-[(2S,3S,4R,5R)-6-(1,3-dithian-2-yl)-2,4,6-trimethyl-1-phenylmethoxy-5-triphenylsilyloxyheptan-3-yl]oxy-dimethylsilane (PubChem CID 10887222) has the molecular formula C45H62O3S2Si2 and a molecular weight of 771.29 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4R,5R)-6-(1,3-dithian-2-yl)-2,4,6-trimethyl-1-phenylmethoxy-5-triphenylsilyloxyheptan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S,4R,5R)-6-(1,3-dithian-2-yl)-2,4,6-trimethyl-1-phenylmethoxy-5-triphenylsilyloxyheptan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10887222 |
| Molecular Formula | C45H62O3S2Si2 |
| Molecular Weight | 771.29 g/mol |
| Exact Mass | 770.37 |
| IUPAC Name | tert-butyl-[(2S,3S,4R,5R)-6-(1,3-dithian-2-yl)-2,4,6-trimethyl-1-phenylmethoxy-5-triphenylsilyloxyheptan-3-yl]oxy-dimethylsilane |
| SMILES | C[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)COCc1ccccc1)[C@@H](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)C1SCCCS1 |
| InChI | InChI=1S/C45H62O3S2Si2/c1-35(33-46-34-37-23-14-10-15-24-37)41(47-51(8,9)44(3,4)5)36(2)42(45(6,7)43-49-31-22-32-50-43)48-52(38-25-16-11-17-26-38,39-27-18-12-19-28-39)40-29-20-13-21-30-40/h10-21,23-30,35-36,41-43H,22,31-34H2,1-9H3/t35-,36+,41-,42+/m0/s1 |
| InChIKey | WRKRCXRWIZLYTD-YJLOWYJOSA-N |
| XLogP | 10.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.29 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|