C36H52N4 — CID 10887480
5,5,10,10,15,15,20,20-octaethyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 10887480) has the molecular formula C36H52N4 and a molecular weight of 540.84 g/mol. Its IUPAC name is 5,5,10,10,15,15,20,20-octaethyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,5,10,10,15,15,20,20-octaethyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 10887480 |
| Molecular Formula | C36H52N4 |
| Molecular Weight | 540.84 g/mol |
| Exact Mass | 540.42 |
| IUPAC Name | 5,5,10,10,15,15,20,20-octaethyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCC1(CC)c2ccc([nH]2)C(CC)(CC)c2ccc([nH]2)C(CC)(CC)c2ccc([nH]2)C(CC)(CC)c2ccc1[nH]2 |
| InChI | InChI=1S/C36H52N4/c1-9-33(10-2)25-17-19-27(37-25)34(11-3,12-4)29-21-23-31(39-29)36(15-7,16-8)32-24-22-30(40-32)35(13-5,14-6)28-20-18-26(33)38-28/h17-24,37-40H,9-16H2,1-8H3 |
| InChIKey | PLXCTDHLMJGGSN-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.84 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |