C18H24Cl2N2O2 — CID 108881051
N-[(2,4-dichlorophenoxy)methyl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carboxamide (PubChem CID 108881051) has the molecular formula C18H24Cl2N2O2 and a molecular weight of 371.31 g/mol. Its IUPAC name is N-[(2,4-dichlorophenoxy)methyl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carboxamide.
| Compound Name | N-[(2,4-dichlorophenoxy)methyl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carboxamide |
|---|---|
| PubChem CID | 108881051 |
| Molecular Formula | C18H24Cl2N2O2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[(2,4-dichlorophenoxy)methyl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carboxamide |
| SMILES | CC1(C)CC2CC(C)(CN2C(=O)NCOc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C18H24Cl2N2O2/c1-17(2)7-13-8-18(3,9-17)10-22(13)16(23)21-11-24-15-5-4-12(19)6-14(15)20/h4-6,13H,7-11H2,1-3H3,(H,21,23) |
| InChIKey | SXVBULMPZCHUAM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|