C24H37BrN2O2 — CID 108882127
N-[3-(2-bromo-4-tert-butylphenoxy)propyl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carboxamide (PubChem CID 108882127) has the molecular formula C24H37BrN2O2 and a molecular weight of 465.48 g/mol. Its IUPAC name is N-[3-(2-bromo-4-tert-butylphenoxy)propyl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carboxamide.
| Compound Name | N-[3-(2-bromo-4-tert-butylphenoxy)propyl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carboxamide |
|---|---|
| PubChem CID | 108882127 |
| Molecular Formula | C24H37BrN2O2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[3-(2-bromo-4-tert-butylphenoxy)propyl]-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carboxamide |
| SMILES | CC1(C)CC2CC(C)(CN2C(=O)NCCCOc2ccc(C(C)(C)C)cc2Br)C1 |
| InChI | InChI=1S/C24H37BrN2O2/c1-22(2,3)17-8-9-20(19(25)12-17)29-11-7-10-26-21(28)27-16-24(6)14-18(27)13-23(4,5)15-24/h8-9,12,18H,7,10-11,13-16H2,1-6H3,(H,26,28) |
| InChIKey | DTHXIBDMNVCEAW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|