C18H29BrN2O3 — CID 108882088
3-[3-(2-bromo-4-tert-butylphenoxy)propyl]-1-ethyl-1-(2-hydroxyethyl)urea (PubChem CID 108882088) has the molecular formula C18H29BrN2O3 and a molecular weight of 401.35 g/mol. Its IUPAC name is 3-[3-(2-bromo-4-tert-butylphenoxy)propyl]-1-ethyl-1-(2-hydroxyethyl)urea.
| Compound Name | 3-[3-(2-bromo-4-tert-butylphenoxy)propyl]-1-ethyl-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 108882088 |
| Molecular Formula | C18H29BrN2O3 |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-[3-(2-bromo-4-tert-butylphenoxy)propyl]-1-ethyl-1-(2-hydroxyethyl)urea |
| SMILES | CCN(CCO)C(=O)NCCCOc1ccc(C(C)(C)C)cc1Br |
| InChI | InChI=1S/C18H29BrN2O3/c1-5-21(10-11-22)17(23)20-9-6-12-24-16-8-7-14(13-15(16)19)18(2,3)4/h7-8,13,22H,5-6,9-12H2,1-4H3,(H,20,23) |
| InChIKey | RGUMIGZNQWTLPN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|