C13H16Cl2N2O2 — CID 108880950
N-[(2,4-dichlorophenoxy)methyl]piperidine-1-carboxamide (PubChem CID 108880950) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is N-[(2,4-dichlorophenoxy)methyl]piperidine-1-carboxamide.
| Compound Name | N-[(2,4-dichlorophenoxy)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 108880950 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-[(2,4-dichlorophenoxy)methyl]piperidine-1-carboxamide |
| SMILES | O=C(NCOc1ccc(Cl)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C13H16Cl2N2O2/c14-10-4-5-12(11(15)8-10)19-9-16-13(18)17-6-2-1-3-7-17/h4-5,8H,1-3,6-7,9H2,(H,16,18) |
| InChIKey | IWMCMSSUZNVTBY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|