C9H20O2 — CID 10888208
(2S)-2-propan-2-ylhexane-1,5-diol (PubChem CID 10888208) has the molecular formula C9H20O2 and a molecular weight of 160.26 g/mol. Its IUPAC name is (2S)-2-propan-2-ylhexane-1,5-diol.
| Compound Name | (2S)-2-propan-2-ylhexane-1,5-diol |
|---|---|
| PubChem CID | 10888208 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | (2S)-2-propan-2-ylhexane-1,5-diol |
| SMILES | CC(O)CC[C@H](CO)C(C)C |
| InChI | InChI=1S/C9H20O2/c1-7(2)9(6-10)5-4-8(3)11/h7-11H,4-6H2,1-3H3/t8?,9-/m1/s1 |
| InChIKey | BWSMMKSVKLSPBB-YGPZHTELSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |