About 2-propan-2-ylpentane-1,4-diol
2-propan-2-ylpentane-1,4-diol (PubChem CID 22619698) has the molecular formula C8H18O2
and a molecular weight of 146.23 g/mol. Its IUPAC name is 2-propan-2-ylpentane-1,4-diol.
Molecular Properties
| Compound Name | 2-propan-2-ylpentane-1,4-diol |
| PubChem CID | 22619698 |
| Molecular Formula | C8H18O2 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | 2-propan-2-ylpentane-1,4-diol |
| SMILES | CC(O)CC(CO)C(C)C |
| InChI | InChI=1S/C8H18O2/c1-6(2)8(5-9)4-7(3)10/h6-10H,4-5H2,1-3H3 |
| InChIKey | GVBPPHRWPUZNJZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-ylpentane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylpentane-1,4-diol?
The IUPAC name of 2-propan-2-ylpentane-1,4-diol (CID 22619698) is 2-propan-2-ylpentane-1,4-diol.
What is the SMILES notation for 2-propan-2-ylpentane-1,4-diol?
The canonical SMILES for 2-propan-2-ylpentane-1,4-diol is CC(O)CC(CO)C(C)C.
What is the InChIKey of 2-propan-2-ylpentane-1,4-diol?
The InChIKey is GVBPPHRWPUZNJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2/c1-6(2)8(5-9)4-7(3)10/h6-10H,4-5H2,1-3H3.
What are the key properties of 2-propan-2-ylpentane-1,4-diol?
2-propan-2-ylpentane-1,4-diol has a molecular weight of 146.23 g/mol, XLogP of 1.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylpentane-1,4-diol is sourced from PubChem (CID 22619698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).