C12H22N2O5S — CID 108887865
1-(1,1-dioxothiolan-3-yl)-1-(2-methoxyethyl)-3-(oxolan-2-yl)urea (PubChem CID 108887865) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-1-(2-methoxyethyl)-3-(oxolan-2-yl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-1-(2-methoxyethyl)-3-(oxolan-2-yl)urea |
|---|---|
| PubChem CID | 108887865 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-1-(2-methoxyethyl)-3-(oxolan-2-yl)urea |
| SMILES | COCCN(C(=O)NC1CCCO1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H22N2O5S/c1-18-7-5-14(10-4-8-20(16,17)9-10)12(15)13-11-3-2-6-19-11/h10-11H,2-9H2,1H3,(H,13,15) |
| InChIKey | NZVWXCWJKABSHZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |