C10H13BrO3 — CID 10890645
(1S,2S,3S,4S,5S,6S,8R,9R,10R)-9-bromo-7-oxatetracyclo[6.3.0.02,6.03,10]undecane-4,5-diol (PubChem CID 10890645) has the molecular formula C10H13BrO3 and a molecular weight of 261.12 g/mol. Its IUPAC name is (1S,2S,3S,4S,5S,6S,8R,9R,10R)-9-bromo-7-oxatetracyclo[6.3.0.02,6.03,10]undecane-4,5-diol.
| Compound Name | (1S,2S,3S,4S,5S,6S,8R,9R,10R)-9-bromo-7-oxatetracyclo[6.3.0.02,6.03,10]undecane-4,5-diol |
|---|---|
| PubChem CID | 10890645 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | (1S,2S,3S,4S,5S,6S,8R,9R,10R)-9-bromo-7-oxatetracyclo[6.3.0.02,6.03,10]undecane-4,5-diol |
| SMILES | O[C@@H]1[C@H](O)[C@H]2O[C@H]3[C@H](Br)[C@@H]4C[C@H]3[C@H]2[C@H]14 |
| InChI | InChI=1S/C10H13BrO3/c11-6-2-1-3-5-4(2)7(12)8(13)10(5)14-9(3)6/h2-10,12-13H,1H2/t2-,3+,4-,5+,6-,7+,8+,9-,10+/m1/s1 |
| InChIKey | RZWDDPQJJUQHJY-ZNOJDRQYSA-N |
| XLogP | 0.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|