About 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline
2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline (PubChem CID 10890702) has the molecular formula C12H13N3O4
and a molecular weight of 263.25 g/mol. Its IUPAC name is 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline.
Molecular Properties
| Compound Name | 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline |
| PubChem CID | 10890702 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline |
| SMILES | COc1nc2cc([N+](=O)[O-])c(C)c(C)c2nc1OC |
| InChI | InChI=1S/C12H13N3O4/c1-6-7(2)10-8(5-9(6)15(16)17)13-11(18-3)12(14-10)19-4/h5H,1-4H3 |
| InChIKey | VWIVBNPDCFQKSA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline?
The IUPAC name of 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline (CID 10890702) is 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline.
What is the SMILES notation for 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline?
The canonical SMILES for 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline is COc1nc2cc([N+](=O)[O-])c(C)c(C)c2nc1OC.
What is the InChIKey of 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline?
The InChIKey is VWIVBNPDCFQKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O4/c1-6-7(2)10-8(5-9(6)15(16)17)13-11(18-3)12(14-10)19-4/h5H,1-4H3.
What are the key properties of 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline?
2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline has a molecular weight of 263.25 g/mol, XLogP of 2.17, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-5,6-dimethyl-7-nitroquinoxaline is sourced from PubChem (CID 10890702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).