C13H14N4O4 — CID 18706780
N-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]ethanimine (PubChem CID 18706780) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is N-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]ethanimine.
| Compound Name | N-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]ethanimine |
|---|---|
| PubChem CID | 18706780 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | N-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]ethanimine |
| SMILES | C/C=N/Cc1cc([N+](=O)[O-])cc2nc(OC)c(OC)nc12 |
| InChI | InChI=1S/C13H14N4O4/c1-4-14-7-8-5-9(17(18)19)6-10-11(8)16-13(21-3)12(15-10)20-2/h4-6H,7H2,1-3H3/b14-4+ |
| InChIKey | UCFRZMUYDCDYHK-LNKIKWGQSA-N |
| XLogP | 2.15 |
| TPSA | 99.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|