C17H25N4O7P — CID 54370181
(1R)-N-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-1-dimethoxyphosphoryl-N-ethylethanamine (PubChem CID 54370181) has the molecular formula C17H25N4O7P and a molecular weight of 428.38 g/mol. Its IUPAC name is (1R)-N-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-1-dimethoxyphosphoryl-N-ethylethanamine.
| Compound Name | (1R)-N-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-1-dimethoxyphosphoryl-N-ethylethanamine |
|---|---|
| PubChem CID | 54370181 |
| Molecular Formula | C17H25N4O7P |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (1R)-N-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-1-dimethoxyphosphoryl-N-ethylethanamine |
| SMILES | CCN(Cc1cc([N+](=O)[O-])cc2nc(OC)c(OC)nc12)[C@@H](C)P(=O)(OC)OC |
| InChI | InChI=1S/C17H25N4O7P/c1-7-20(11(2)29(24,27-5)28-6)10-12-8-13(21(22)23)9-14-15(12)19-17(26-4)16(18-14)25-3/h8-9,11H,7,10H2,1-6H3/t11-/m1/s1 |
| InChIKey | USQDTUQBMYGSMF-LLVKDONJSA-N |
| XLogP | 3.21 |
| TPSA | 126.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|