C15H16N4O7 — CID 67626327
4-amino-3-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-4-oxobutanoic acid (PubChem CID 67626327) has the molecular formula C15H16N4O7 and a molecular weight of 364.31 g/mol. Its IUPAC name is 4-amino-3-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-4-oxobutanoic acid.
| Compound Name | 4-amino-3-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67626327 |
| Molecular Formula | C15H16N4O7 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 4-amino-3-[(2,3-dimethoxy-7-nitroquinoxalin-5-yl)methyl]-4-oxobutanoic acid |
| SMILES | COc1nc2cc([N+](=O)[O-])cc(CC(CC(=O)O)C(N)=O)c2nc1OC |
| InChI | InChI=1S/C15H16N4O7/c1-25-14-15(26-2)18-12-7(3-8(13(16)22)5-11(20)21)4-9(19(23)24)6-10(12)17-14/h4,6,8H,3,5H2,1-2H3,(H2,16,22)(H,20,21) |
| InChIKey | BAQXTEUHZXZFGY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|