C15H16N4O6 — CID 18706415
1-(2,3-dimethoxy-7-nitroquinoxalin-5-yl)but-3-enylcarbamic acid (PubChem CID 18706415) has the molecular formula C15H16N4O6 and a molecular weight of 348.32 g/mol. Its IUPAC name is 1-(2,3-dimethoxy-7-nitroquinoxalin-5-yl)but-3-enylcarbamic acid.
| Compound Name | 1-(2,3-dimethoxy-7-nitroquinoxalin-5-yl)but-3-enylcarbamic acid |
|---|---|
| PubChem CID | 18706415 |
| Molecular Formula | C15H16N4O6 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-(2,3-dimethoxy-7-nitroquinoxalin-5-yl)but-3-enylcarbamic acid |
| SMILES | C=CCC(NC(=O)O)c1cc([N+](=O)[O-])cc2nc(OC)c(OC)nc12 |
| InChI | InChI=1S/C15H16N4O6/c1-4-5-10(17-15(20)21)9-6-8(19(22)23)7-11-12(9)18-14(25-3)13(16-11)24-2/h4,6-7,10,17H,1,5H2,2-3H3,(H,20,21) |
| InChIKey | SOMPYYFBXRPTFC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|