C14H26O3Si — CID 10890954
methyl (3S,4E)-3-[tert-butyl(dimethyl)silyl]oxyhepta-4,6-dienoate (PubChem CID 10890954) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is methyl (3S,4E)-3-[tert-butyl(dimethyl)silyl]oxyhepta-4,6-dienoate.
| Compound Name | methyl (3S,4E)-3-[tert-butyl(dimethyl)silyl]oxyhepta-4,6-dienoate |
|---|---|
| PubChem CID | 10890954 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | methyl (3S,4E)-3-[tert-butyl(dimethyl)silyl]oxyhepta-4,6-dienoate |
| SMILES | C=C/C=C/[C@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O3Si/c1-8-9-10-12(11-13(15)16-5)17-18(6,7)14(2,3)4/h8-10,12H,1,11H2,2-7H3/b10-9+/t12-/m1/s1 |
| InChIKey | KFKDQTGGTLGJRP-BZYZDCJZSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|