C17H28OSi — CID 10891131
[(4aS,8aS)-4,8a-dihydro-3H-naphthalen-4a-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10891131) has the molecular formula C17H28OSi and a molecular weight of 276.50 g/mol. Its IUPAC name is [(4aS,8aS)-4,8a-dihydro-3H-naphthalen-4a-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aS,8aS)-4,8a-dihydro-3H-naphthalen-4a-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10891131 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | [(4aS,8aS)-4,8a-dihydro-3H-naphthalen-4a-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]12C=CC=C[C@@H]1C=CCC2 |
| InChI | InChI=1S/C17H28OSi/c1-16(2,3)19(4,5)18-14-17-12-8-6-10-15(17)11-7-9-13-17/h6-8,10-12,15H,9,13-14H2,1-5H3/t15-,17+/m1/s1 |
| InChIKey | GBLOHMJLMWOOIG-WBVHZDCISA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|